C8H10F3N3O — CID 136957960
4-[methyl(3,3,3-trifluoropropyl)amino]-1H-pyrimidin-6-one (PubChem CID 136957960) has the molecular formula C8H10F3N3O and a molecular weight of 221.18 g/mol. Its IUPAC name is 4-[methyl(3,3,3-trifluoropropyl)amino]-1H-pyrimidin-6-one.
| Compound Name | 4-[methyl(3,3,3-trifluoropropyl)amino]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136957960 |
| Molecular Formula | C8H10F3N3O |
| Molecular Weight | 221.18 g/mol |
| Exact Mass | 221.08 |
| IUPAC Name | 4-[methyl(3,3,3-trifluoropropyl)amino]-1H-pyrimidin-6-one |
| SMILES | CN(CCC(F)(F)F)c1cc(=O)[nH]cn1 |
| InChI | InChI=1S/C8H10F3N3O/c1-14(3-2-8(9,10)11)6-4-7(15)13-5-12-6/h4-5H,2-3H2,1H3,(H,12,13,15) |
| InChIKey | YAWGTIBVWZZJEF-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.18 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |