C15H18N4O — CID 136965871
2-(benzylamino)-3,5,6,7,8,9-hexahydropyrimido[4,5-d]azepin-4-one (PubChem CID 136965871) has the molecular formula C15H18N4O and a molecular weight of 270.34 g/mol. Its IUPAC name is 2-(benzylamino)-3,5,6,7,8,9-hexahydropyrimido[4,5-d]azepin-4-one.
| Compound Name | 2-(benzylamino)-3,5,6,7,8,9-hexahydropyrimido[4,5-d]azepin-4-one |
|---|---|
| PubChem CID | 136965871 |
| Molecular Formula | C15H18N4O |
| Molecular Weight | 270.34 g/mol |
| Exact Mass | 270.15 |
| IUPAC Name | 2-(benzylamino)-3,5,6,7,8,9-hexahydropyrimido[4,5-d]azepin-4-one |
| SMILES | O=c1[nH]c(NCc2ccccc2)nc2c1CCNCC2 |
| InChI | InChI=1S/C15H18N4O/c20-14-12-6-8-16-9-7-13(12)18-15(19-14)17-10-11-4-2-1-3-5-11/h1-5,16H,6-10H2,(H2,17,18,19,20) |
| InChIKey | VAIIVFCLUAIRHN-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 69.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.34 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |