C15H18N4S — CID 117102430
4-(benzylamino)-1,5,6,7,8,9-hexahydropyrimido[4,5-d]azepine-2-thione (PubChem CID 117102430) has the molecular formula C15H18N4S and a molecular weight of 286.40 g/mol. Its IUPAC name is 4-(benzylamino)-1,5,6,7,8,9-hexahydropyrimido[4,5-d]azepine-2-thione.
| Compound Name | 4-(benzylamino)-1,5,6,7,8,9-hexahydropyrimido[4,5-d]azepine-2-thione |
|---|---|
| PubChem CID | 117102430 |
| Molecular Formula | C15H18N4S |
| Molecular Weight | 286.40 g/mol |
| Exact Mass | 286.13 |
| IUPAC Name | 4-(benzylamino)-1,5,6,7,8,9-hexahydropyrimido[4,5-d]azepine-2-thione |
| SMILES | S=c1nc(NCc2ccccc2)c2c([nH]1)CCNCC2 |
| InChI | InChI=1S/C15H18N4S/c20-15-18-13-7-9-16-8-6-12(13)14(19-15)17-10-11-4-2-1-3-5-11/h1-5,16H,6-10H2,(H2,17,18,19,20) |
| InChIKey | GNOHXWXKYYDXCI-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 52.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.40 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|