C14H8N6 — CID 154109669
6-(benzylamino)pyrazine-2,3,5-tricarbonitrile (PubChem CID 154109669) has the molecular formula C14H8N6 and a molecular weight of 260.26 g/mol. Its IUPAC name is 6-(benzylamino)pyrazine-2,3,5-tricarbonitrile.
| Compound Name | 6-(benzylamino)pyrazine-2,3,5-tricarbonitrile |
|---|---|
| PubChem CID | 154109669 |
| Molecular Formula | C14H8N6 |
| Molecular Weight | 260.26 g/mol |
| Exact Mass | 260.08 |
| IUPAC Name | 6-(benzylamino)pyrazine-2,3,5-tricarbonitrile |
| SMILES | N#Cc1nc(C#N)c(NCc2ccccc2)nc1C#N |
| InChI | InChI=1S/C14H8N6/c15-6-11-12(7-16)20-14(13(8-17)19-11)18-9-10-4-2-1-3-5-10/h1-5H,9H2,(H,18,20) |
| InChIKey | VHHIHURVUUGJRH-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 109.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.26 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |