C13H7ClN4 — CID 13336835
5-benzyl-6-chloropyrazine-2,3-dicarbonitrile (PubChem CID 13336835) has the molecular formula C13H7ClN4 and a molecular weight of 254.68 g/mol. Its IUPAC name is 5-benzyl-6-chloropyrazine-2,3-dicarbonitrile.
| Compound Name | 5-benzyl-6-chloropyrazine-2,3-dicarbonitrile |
|---|---|
| PubChem CID | 13336835 |
| Molecular Formula | C13H7ClN4 |
| Molecular Weight | 254.68 g/mol |
| Exact Mass | 254.04 |
| IUPAC Name | 5-benzyl-6-chloropyrazine-2,3-dicarbonitrile |
| SMILES | N#Cc1nc(Cl)c(Cc2ccccc2)nc1C#N |
| InChI | InChI=1S/C13H7ClN4/c14-13-10(6-9-4-2-1-3-5-9)17-11(7-15)12(8-16)18-13/h1-5H,6H2 |
| InChIKey | FEPGBNKABMIKPA-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 73.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.68 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |