C10H11N5O — CID 136701605
6-amino-3-(benzylamino)-4H-1,2,4-triazin-5-one (PubChem CID 136701605) has the molecular formula C10H11N5O and a molecular weight of 217.23 g/mol. Its IUPAC name is 6-amino-3-(benzylamino)-4H-1,2,4-triazin-5-one.
| Compound Name | 6-amino-3-(benzylamino)-4H-1,2,4-triazin-5-one |
|---|---|
| PubChem CID | 136701605 |
| Molecular Formula | C10H11N5O |
| Molecular Weight | 217.23 g/mol |
| Exact Mass | 217.10 |
| IUPAC Name | 6-amino-3-(benzylamino)-4H-1,2,4-triazin-5-one |
| SMILES | Nc1nnc(NCc2ccccc2)[nH]c1=O |
| InChI | InChI=1S/C10H11N5O/c11-8-9(16)13-10(15-14-8)12-6-7-4-2-1-3-5-7/h1-5H,6H2,(H2,11,14)(H2,12,13,15,16) |
| InChIKey | IJJXAKBJNBCCJA-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 96.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.23 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |