C12H8N4O3S2 — CID 136969154
(2E)-2-[[4-(4-nitrophenyl)-1,3-thiazol-2-yl]imino]-1,3-thiazolidin-4-one (PubChem CID 136969154) has the molecular formula C12H8N4O3S2 and a molecular weight of 320.36 g/mol. Its IUPAC name is (2E)-2-[[4-(4-nitrophenyl)-1,3-thiazol-2-yl]imino]-1,3-thiazolidin-4-one.
| Compound Name | (2E)-2-[[4-(4-nitrophenyl)-1,3-thiazol-2-yl]imino]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 136969154 |
| Molecular Formula | C12H8N4O3S2 |
| Molecular Weight | 320.36 g/mol |
| Exact Mass | 320.00 |
| IUPAC Name | (2E)-2-[[4-(4-nitrophenyl)-1,3-thiazol-2-yl]imino]-1,3-thiazolidin-4-one |
| SMILES | O=C1CS/C(=N/c2nc(-c3ccc([N+](=O)[O-])cc3)cs2)N1 |
| InChI | InChI=1S/C12H8N4O3S2/c17-10-6-21-12(14-10)15-11-13-9(5-20-11)7-1-3-8(4-2-7)16(18)19/h1-5H,6H2,(H,13,14,15,17) |
| InChIKey | UGQVBGOXPMGUDQ-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 97.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.36 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|