C14H11N5O2S2 — CID 91929539
[4-(4-nitrophenyl)-1,3-thiazol-2-yl]-[1-(1,3-thiazol-2-yl)ethyl]diazene (PubChem CID 91929539) has the molecular formula C14H11N5O2S2 and a molecular weight of 345.41 g/mol. Its IUPAC name is [4-(4-nitrophenyl)-1,3-thiazol-2-yl]-[1-(1,3-thiazol-2-yl)ethyl]diazene.
| Compound Name | [4-(4-nitrophenyl)-1,3-thiazol-2-yl]-[1-(1,3-thiazol-2-yl)ethyl]diazene |
|---|---|
| PubChem CID | 91929539 |
| Molecular Formula | C14H11N5O2S2 |
| Molecular Weight | 345.41 g/mol |
| Exact Mass | 345.04 |
| IUPAC Name | [4-(4-nitrophenyl)-1,3-thiazol-2-yl]-[1-(1,3-thiazol-2-yl)ethyl]diazene |
| SMILES | CC(/N=N/c1nc(-c2ccc([N+](=O)[O-])cc2)cs1)c1nccs1 |
| InChI | InChI=1S/C14H11N5O2S2/c1-9(13-15-6-7-22-13)17-18-14-16-12(8-23-14)10-2-4-11(5-3-10)19(20)21/h2-9H,1H3/b18-17+ |
| InChIKey | YEZBCXVMVJDEQX-ISLYRVAYSA-N |
| XLogP | 5.02 |
| TPSA | 93.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.41 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|