C14H14IN3O — CID 136970813
4-[benzyl(cyclopropyl)amino]-5-iodo-1H-pyrimidin-6-one (PubChem CID 136970813) has the molecular formula C14H14IN3O and a molecular weight of 367.19 g/mol. Its IUPAC name is 4-[benzyl(cyclopropyl)amino]-5-iodo-1H-pyrimidin-6-one.
| Compound Name | 4-[benzyl(cyclopropyl)amino]-5-iodo-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136970813 |
| Molecular Formula | C14H14IN3O |
| Molecular Weight | 367.19 g/mol |
| Exact Mass | 367.02 |
| IUPAC Name | 4-[benzyl(cyclopropyl)amino]-5-iodo-1H-pyrimidin-6-one |
| SMILES | O=c1[nH]cnc(N(Cc2ccccc2)C2CC2)c1I |
| InChI | InChI=1S/C14H14IN3O/c15-12-13(16-9-17-14(12)19)18(11-6-7-11)8-10-4-2-1-3-5-10/h1-5,9,11H,6-8H2,(H,16,17,19) |
| InChIKey | UOXDCLIIOGGNFT-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.19 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|