C11H16IN3O — CID 136970944
4-(2,6-dimethylpiperidin-1-yl)-5-iodo-1H-pyrimidin-6-one (PubChem CID 136970944) has the molecular formula C11H16IN3O and a molecular weight of 333.17 g/mol. Its IUPAC name is 4-(2,6-dimethylpiperidin-1-yl)-5-iodo-1H-pyrimidin-6-one.
| Compound Name | 4-(2,6-dimethylpiperidin-1-yl)-5-iodo-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136970944 |
| Molecular Formula | C11H16IN3O |
| Molecular Weight | 333.17 g/mol |
| Exact Mass | 333.03 |
| IUPAC Name | 4-(2,6-dimethylpiperidin-1-yl)-5-iodo-1H-pyrimidin-6-one |
| SMILES | CC1CCCC(C)N1c1nc[nH]c(=O)c1I |
| InChI | InChI=1S/C11H16IN3O/c1-7-4-3-5-8(2)15(7)10-9(12)11(16)14-6-13-10/h6-8H,3-5H2,1-2H3,(H,13,14,16) |
| InChIKey | UZRMGHFVBRNOOU-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.17 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|