C12H10N4OS — CID 136980121
2-amino-6-(5-thiophen-2-yl-1H-1,2,4-triazol-3-yl)phenol (PubChem CID 136980121) has the molecular formula C12H10N4OS and a molecular weight of 258.31 g/mol. Its IUPAC name is 2-amino-6-(5-thiophen-2-yl-1H-1,2,4-triazol-3-yl)phenol.
| Compound Name | 2-amino-6-(5-thiophen-2-yl-1H-1,2,4-triazol-3-yl)phenol |
|---|---|
| PubChem CID | 136980121 |
| Molecular Formula | C12H10N4OS |
| Molecular Weight | 258.31 g/mol |
| Exact Mass | 258.06 |
| IUPAC Name | 2-amino-6-(5-thiophen-2-yl-1H-1,2,4-triazol-3-yl)phenol |
| SMILES | Nc1cccc(-c2n[nH]c(-c3cccs3)n2)c1O |
| InChI | InChI=1S/C12H10N4OS/c13-8-4-1-3-7(10(8)17)11-14-12(16-15-11)9-5-2-6-18-9/h1-6,17H,13H2,(H,14,15,16) |
| InChIKey | KTUXFCUAWHVMEZ-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 87.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.31 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|