C42H34FN5O — CID 136984209
6-[(1R)-1-(4-fluorophenyl)ethyl]-3-(2-methyl-4-pyridinyl)-1-trityl-5,8-dihydropyrazolo[4,5-g]quinazolin-7-one (PubChem CID 136984209) has the molecular formula C42H34FN5O and a molecular weight of 643.77 g/mol. Its IUPAC name is 6-[(1R)-1-(4-fluorophenyl)ethyl]-3-(2-methyl-4-pyridinyl)-1-trityl-5,8-dihydropyrazolo[4,5-g]quinazolin-7-one.
| Compound Name | 6-[(1R)-1-(4-fluorophenyl)ethyl]-3-(2-methyl-4-pyridinyl)-1-trityl-5,8-dihydropyrazolo[4,5-g]quinazolin-7-one |
|---|---|
| PubChem CID | 136984209 |
| Molecular Formula | C42H34FN5O |
| Molecular Weight | 643.77 g/mol |
| Exact Mass | 643.27 |
| IUPAC Name | 6-[(1R)-1-(4-fluorophenyl)ethyl]-3-(2-methyl-4-pyridinyl)-1-trityl-5,8-dihydropyrazolo[4,5-g]quinazolin-7-one |
| SMILES | Cc1cc(-c2nn(C(c3ccccc3)(c3ccccc3)c3ccccc3)c3cc4c(cc23)CN([C@H](C)c2ccc(F)cc2)C(=O)N4)ccn1 |
| InChI | InChI=1S/C42H34FN5O/c1-28-24-31(22-23-44-28)40-37-25-32-27-47(29(2)30-18-20-36(43)21-19-30)41(49)45-38(32)26-39(37)48(46-40)42(33-12-6-3-7-13-33,34-14-8-4-9-15-34)35-16-10-5-11-17-35/h3-26,29H,27H2,1-2H3,(H,45,49)/t29-/m1/s1 |
| InChIKey | CLCVUEFDXSAUNM-GDLZYMKVSA-N |
| XLogP | 9.49 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.77 |
| LogP ≤ 5 | 9.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|