C38H35N5O — CID 136984195
3-(ethylamino)-6-[(1R)-1-phenylethyl]-1-trityl-5,8-dihydropyrazolo[4,5-g]quinazolin-7-one (PubChem CID 136984195) has the molecular formula C38H35N5O and a molecular weight of 577.73 g/mol. Its IUPAC name is 3-(ethylamino)-6-[(1R)-1-phenylethyl]-1-trityl-5,8-dihydropyrazolo[4,5-g]quinazolin-7-one.
| Compound Name | 3-(ethylamino)-6-[(1R)-1-phenylethyl]-1-trityl-5,8-dihydropyrazolo[4,5-g]quinazolin-7-one |
|---|---|
| PubChem CID | 136984195 |
| Molecular Formula | C38H35N5O |
| Molecular Weight | 577.73 g/mol |
| Exact Mass | 577.28 |
| IUPAC Name | 3-(ethylamino)-6-[(1R)-1-phenylethyl]-1-trityl-5,8-dihydropyrazolo[4,5-g]quinazolin-7-one |
| SMILES | CCNc1nn(C(c2ccccc2)(c2ccccc2)c2ccccc2)c2cc3c(cc12)CN([C@H](C)c1ccccc1)C(=O)N3 |
| InChI | InChI=1S/C38H35N5O/c1-3-39-36-33-24-29-26-42(27(2)28-16-8-4-9-17-28)37(44)40-34(29)25-35(33)43(41-36)38(30-18-10-5-11-19-30,31-20-12-6-13-21-31)32-22-14-7-15-23-32/h4-25,27H,3,26H2,1-2H3,(H,39,41)(H,40,44)/t27-/m1/s1 |
| InChIKey | OUZRKWMSAKLRRS-HHHXNRCGSA-N |
| XLogP | 8.42 |
| TPSA | 62.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.73 |
| LogP ≤ 5 | 8.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|