C36H28BrClN4O — CID 136997182
3-bromo-6-[(3-chlorophenyl)methyl]-1-trityl-7,9-dihydro-5H-pyrazolo[4,5-h][1,4]benzodiazepin-8-one (PubChem CID 136997182) has the molecular formula C36H28BrClN4O and a molecular weight of 648.00 g/mol. Its IUPAC name is 3-bromo-6-[(3-chlorophenyl)methyl]-1-trityl-7,9-dihydro-5H-pyrazolo[4,5-h][1,4]benzodiazepin-8-one.
| Compound Name | 3-bromo-6-[(3-chlorophenyl)methyl]-1-trityl-7,9-dihydro-5H-pyrazolo[4,5-h][1,4]benzodiazepin-8-one |
|---|---|
| PubChem CID | 136997182 |
| Molecular Formula | C36H28BrClN4O |
| Molecular Weight | 648.00 g/mol |
| Exact Mass | 646.11 |
| IUPAC Name | 3-bromo-6-[(3-chlorophenyl)methyl]-1-trityl-7,9-dihydro-5H-pyrazolo[4,5-h][1,4]benzodiazepin-8-one |
| SMILES | O=C1CN(Cc2cccc(Cl)c2)Cc2cc3c(Br)nn(C(c4ccccc4)(c4ccccc4)c4ccccc4)c3cc2N1 |
| InChI | InChI=1S/C36H28BrClN4O/c37-35-31-20-26-23-41(22-25-11-10-18-30(38)19-25)24-34(43)39-32(26)21-33(31)42(40-35)36(27-12-4-1-5-13-27,28-14-6-2-7-15-28)29-16-8-3-9-17-29/h1-21H,22-24H2,(H,39,43) |
| InChIKey | OWWXGKHZEBEVDR-UHFFFAOYSA-N |
| XLogP | 8.25 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.00 |
| LogP ≤ 5 | 8.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|