C37H32N4O2 — CID 136984215
3-methoxy-6-[(1R)-1-phenylethyl]-1-trityl-5,8-dihydropyrazolo[4,5-g]quinazolin-7-one (PubChem CID 136984215) has the molecular formula C37H32N4O2 and a molecular weight of 564.69 g/mol. Its IUPAC name is 3-methoxy-6-[(1R)-1-phenylethyl]-1-trityl-5,8-dihydropyrazolo[4,5-g]quinazolin-7-one.
| Compound Name | 3-methoxy-6-[(1R)-1-phenylethyl]-1-trityl-5,8-dihydropyrazolo[4,5-g]quinazolin-7-one |
|---|---|
| PubChem CID | 136984215 |
| Molecular Formula | C37H32N4O2 |
| Molecular Weight | 564.69 g/mol |
| Exact Mass | 564.25 |
| IUPAC Name | 3-methoxy-6-[(1R)-1-phenylethyl]-1-trityl-5,8-dihydropyrazolo[4,5-g]quinazolin-7-one |
| SMILES | COc1nn(C(c2ccccc2)(c2ccccc2)c2ccccc2)c2cc3c(cc12)CN([C@H](C)c1ccccc1)C(=O)N3 |
| InChI | InChI=1S/C37H32N4O2/c1-26(27-15-7-3-8-16-27)40-25-28-23-32-34(24-33(28)38-36(40)42)41(39-35(32)43-2)37(29-17-9-4-10-18-29,30-19-11-5-12-20-30)31-21-13-6-14-22-31/h3-24,26H,25H2,1-2H3,(H,38,42)/t26-/m1/s1 |
| InChIKey | QJUYSTNGOVTSGC-AREMUKBSSA-N |
| XLogP | 7.99 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.69 |
| LogP ≤ 5 | 7.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|