C13H23N3OS — CID 136985094
N-cyclopropyl-4-[(4,4-dimethyl-1,3-thiazinan-2-ylidene)amino]butanamide (PubChem CID 136985094) has the molecular formula C13H23N3OS and a molecular weight of 269.41 g/mol. Its IUPAC name is N-cyclopropyl-4-[(4,4-dimethyl-1,3-thiazinan-2-ylidene)amino]butanamide.
| Compound Name | N-cyclopropyl-4-[(4,4-dimethyl-1,3-thiazinan-2-ylidene)amino]butanamide |
|---|---|
| PubChem CID | 136985094 |
| Molecular Formula | C13H23N3OS |
| Molecular Weight | 269.41 g/mol |
| Exact Mass | 269.16 |
| IUPAC Name | N-cyclopropyl-4-[(4,4-dimethyl-1,3-thiazinan-2-ylidene)amino]butanamide |
| SMILES | CC1(C)CCS/C(=N\CCCC(=O)NC2CC2)N1 |
| InChI | InChI=1S/C13H23N3OS/c1-13(2)7-9-18-12(16-13)14-8-3-4-11(17)15-10-5-6-10/h10H,3-9H2,1-2H3,(H,14,16)(H,15,17) |
| InChIKey | LGPNHCBJJXIHLY-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 53.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.41 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|