C12H8F3N3O — CID 136985587
3-[6-(trifluoromethyl)-1H-indol-2-yl]-1,2-oxazol-5-amine (PubChem CID 136985587) has the molecular formula C12H8F3N3O and a molecular weight of 267.21 g/mol. Its IUPAC name is 3-[6-(trifluoromethyl)-1H-indol-2-yl]-1,2-oxazol-5-amine.
| Compound Name | 3-[6-(trifluoromethyl)-1H-indol-2-yl]-1,2-oxazol-5-amine |
|---|---|
| PubChem CID | 136985587 |
| Molecular Formula | C12H8F3N3O |
| Molecular Weight | 267.21 g/mol |
| Exact Mass | 267.06 |
| IUPAC Name | 3-[6-(trifluoromethyl)-1H-indol-2-yl]-1,2-oxazol-5-amine |
| SMILES | Nc1cc(-c2cc3ccc(C(F)(F)F)cc3[nH]2)no1 |
| InChI | InChI=1S/C12H8F3N3O/c13-12(14,15)7-2-1-6-3-9(17-8(6)4-7)10-5-11(16)19-18-10/h1-5,17H,16H2 |
| InChIKey | BXXZGUQZNBJPKL-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 67.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.21 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |