C13H10N2O4 — CID 136985700
3-(4-methoxy-1H-indol-2-yl)-1,2-oxazole-5-carboxylic acid (PubChem CID 136985700) has the molecular formula C13H10N2O4 and a molecular weight of 258.23 g/mol. Its IUPAC name is 3-(4-methoxy-1H-indol-2-yl)-1,2-oxazole-5-carboxylic acid.
| Compound Name | 3-(4-methoxy-1H-indol-2-yl)-1,2-oxazole-5-carboxylic acid |
|---|---|
| PubChem CID | 136985700 |
| Molecular Formula | C13H10N2O4 |
| Molecular Weight | 258.23 g/mol |
| Exact Mass | 258.06 |
| IUPAC Name | 3-(4-methoxy-1H-indol-2-yl)-1,2-oxazole-5-carboxylic acid |
| SMILES | COc1cccc2[nH]c(-c3cc(C(=O)O)on3)cc12 |
| InChI | InChI=1S/C13H10N2O4/c1-18-11-4-2-3-8-7(11)5-9(14-8)10-6-12(13(16)17)19-15-10/h2-6,14H,1H3,(H,16,17) |
| InChIKey | XAYNLJYLBSQOCH-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 88.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.23 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |