C14H16N4 — CID 136986277
5-(2,5-dimethyl-1H-indol-3-yl)-1-methylpyrazol-4-amine (PubChem CID 136986277) has the molecular formula C14H16N4 and a molecular weight of 240.31 g/mol. Its IUPAC name is 5-(2,5-dimethyl-1H-indol-3-yl)-1-methylpyrazol-4-amine.
| Compound Name | 5-(2,5-dimethyl-1H-indol-3-yl)-1-methylpyrazol-4-amine |
|---|---|
| PubChem CID | 136986277 |
| Molecular Formula | C14H16N4 |
| Molecular Weight | 240.31 g/mol |
| Exact Mass | 240.14 |
| IUPAC Name | 5-(2,5-dimethyl-1H-indol-3-yl)-1-methylpyrazol-4-amine |
| SMILES | Cc1ccc2[nH]c(C)c(-c3c(N)cnn3C)c2c1 |
| InChI | InChI=1S/C14H16N4/c1-8-4-5-12-10(6-8)13(9(2)17-12)14-11(15)7-16-18(14)3/h4-7,17H,15H2,1-3H3 |
| InChIKey | IQYRJVJUOBYEPR-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 59.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.31 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |