C11H15IN4O2 — CID 136990127
1-(5-iodo-6-oxo-1H-pyrimidin-4-yl)-N-methylpiperidine-2-carboxamide (PubChem CID 136990127) has the molecular formula C11H15IN4O2 and a molecular weight of 362.17 g/mol. Its IUPAC name is 1-(5-iodo-6-oxo-1H-pyrimidin-4-yl)-N-methylpiperidine-2-carboxamide.
| Compound Name | 1-(5-iodo-6-oxo-1H-pyrimidin-4-yl)-N-methylpiperidine-2-carboxamide |
|---|---|
| PubChem CID | 136990127 |
| Molecular Formula | C11H15IN4O2 |
| Molecular Weight | 362.17 g/mol |
| Exact Mass | 362.02 |
| IUPAC Name | 1-(5-iodo-6-oxo-1H-pyrimidin-4-yl)-N-methylpiperidine-2-carboxamide |
| SMILES | CNC(=O)C1CCCCN1c1nc[nH]c(=O)c1I |
| InChI | InChI=1S/C11H15IN4O2/c1-13-10(17)7-4-2-3-5-16(7)9-8(12)11(18)15-6-14-9/h6-7H,2-5H2,1H3,(H,13,17)(H,14,15,18) |
| InChIKey | GKZYRWGNFLYBIX-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 78.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.17 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|