C16H22N6O2 — CID 136994758
acetic acid;12-(1,3-dimethylpiperidin-4-yl)-1,5,7,10,11-pentazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaene (PubChem CID 136994758) has the molecular formula C16H22N6O2 and a molecular weight of 330.39 g/mol. Its IUPAC name is acetic acid;12-(1,3-dimethylpiperidin-4-yl)-1,5,7,10,11-pentazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaene.
| Compound Name | acetic acid;12-(1,3-dimethylpiperidin-4-yl)-1,5,7,10,11-pentazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaene |
|---|---|
| PubChem CID | 136994758 |
| Molecular Formula | C16H22N6O2 |
| Molecular Weight | 330.39 g/mol |
| Exact Mass | 330.18 |
| IUPAC Name | acetic acid;12-(1,3-dimethylpiperidin-4-yl)-1,5,7,10,11-pentazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaene |
| SMILES | CC(=O)O.CC1CN(C)CCC1c1nnc2cnc3[nH]ccc3n12 |
| InChI | InChI=1S/C14H18N6.C2H4O2/c1-9-8-19(2)6-4-10(9)14-18-17-12-7-16-13-11(20(12)14)3-5-15-13;1-2(3)4/h3,5,7,9-10,15H,4,6,8H2,1-2H3;1H3,(H,3,4) |
| InChIKey | XHNTZNXVNDABPO-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 99.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.39 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |