C10H17FN2O3S — CID 137029806
7-fluoro-5-(2-hydroxypropan-2-yl)-2-methylimino-1,3a,5,6,7,7a-hexahydropyrano[3,2-d][1,3]thiazol-6-ol (PubChem CID 137029806) has the molecular formula C10H17FN2O3S and a molecular weight of 264.32 g/mol. Its IUPAC name is 7-fluoro-5-(2-hydroxypropan-2-yl)-2-methylimino-1,3a,5,6,7,7a-hexahydropyrano[3,2-d][1,3]thiazol-6-ol.
| Compound Name | 7-fluoro-5-(2-hydroxypropan-2-yl)-2-methylimino-1,3a,5,6,7,7a-hexahydropyrano[3,2-d][1,3]thiazol-6-ol |
|---|---|
| PubChem CID | 137029806 |
| Molecular Formula | C10H17FN2O3S |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.09 |
| IUPAC Name | 7-fluoro-5-(2-hydroxypropan-2-yl)-2-methylimino-1,3a,5,6,7,7a-hexahydropyrano[3,2-d][1,3]thiazol-6-ol |
| SMILES | C/N=C1/NC2C(OC(C(C)(C)O)C(O)C2F)S1 |
| InChI | InChI=1S/C10H17FN2O3S/c1-10(2,15)7-6(14)4(11)5-8(16-7)17-9(12-3)13-5/h4-8,14-15H,1-3H3,(H,12,13) |
| InChIKey | IKBRSUKTDUXJPM-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 74.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|