C19H21IN4O2 — CID 137045658
2-hydroxy-N-[2-(6-iodo-6-methyl-1,4,5,7-tetrahydroindazol-3-yl)-1H-indol-5-yl]-N-methylacetamide (PubChem CID 137045658) has the molecular formula C19H21IN4O2 and a molecular weight of 464.31 g/mol. Its IUPAC name is 2-hydroxy-N-[2-(6-iodo-6-methyl-1,4,5,7-tetrahydroindazol-3-yl)-1H-indol-5-yl]-N-methylacetamide.
| Compound Name | 2-hydroxy-N-[2-(6-iodo-6-methyl-1,4,5,7-tetrahydroindazol-3-yl)-1H-indol-5-yl]-N-methylacetamide |
|---|---|
| PubChem CID | 137045658 |
| Molecular Formula | C19H21IN4O2 |
| Molecular Weight | 464.31 g/mol |
| Exact Mass | 464.07 |
| IUPAC Name | 2-hydroxy-N-[2-(6-iodo-6-methyl-1,4,5,7-tetrahydroindazol-3-yl)-1H-indol-5-yl]-N-methylacetamide |
| SMILES | CN(C(=O)CO)c1ccc2[nH]c(-c3n[nH]c4c3CCC(C)(I)C4)cc2c1 |
| InChI | InChI=1S/C19H21IN4O2/c1-19(20)6-5-13-16(9-19)22-23-18(13)15-8-11-7-12(3-4-14(11)21-15)24(2)17(26)10-25/h3-4,7-8,21,25H,5-6,9-10H2,1-2H3,(H,22,23) |
| InChIKey | LRHMWJAVEJLAOT-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 85.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.31 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|