C10H17N4O5P — CID 137057567
1-[methyl-[5-(methylideneamino)-6-oxo-1H-pyrimidin-4-yl]amino]propan-2-yloxymethylphosphonic acid (PubChem CID 137057567) has the molecular formula C10H17N4O5P and a molecular weight of 304.24 g/mol. Its IUPAC name is 1-[methyl-[5-(methylideneamino)-6-oxo-1H-pyrimidin-4-yl]amino]propan-2-yloxymethylphosphonic acid.
| Compound Name | 1-[methyl-[5-(methylideneamino)-6-oxo-1H-pyrimidin-4-yl]amino]propan-2-yloxymethylphosphonic acid |
|---|---|
| PubChem CID | 137057567 |
| Molecular Formula | C10H17N4O5P |
| Molecular Weight | 304.24 g/mol |
| Exact Mass | 304.09 |
| IUPAC Name | 1-[methyl-[5-(methylideneamino)-6-oxo-1H-pyrimidin-4-yl]amino]propan-2-yloxymethylphosphonic acid |
| SMILES | C=Nc1c(N(C)CC(C)OCP(=O)(O)O)nc[nH]c1=O |
| InChI | InChI=1S/C10H17N4O5P/c1-7(19-6-20(16,17)18)4-14(3)9-8(11-2)10(15)13-5-12-9/h5,7H,2,4,6H2,1,3H3,(H,12,13,15)(H2,16,17,18) |
| InChIKey | ZERFEUVZQDQGQG-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 128.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.24 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|