C19H19BrN2O4S2 — CID 137057643
N-[(Z)-(2-bromo-4-hydroxy-5-methoxyphenyl)methylideneamino]-2-[4-(1,3-dithiolan-2-yl)phenoxy]acetamide (PubChem CID 137057643) has the molecular formula C19H19BrN2O4S2 and a molecular weight of 483.41 g/mol. Its IUPAC name is N-[(Z)-(2-bromo-4-hydroxy-5-methoxyphenyl)methylideneamino]-2-[4-(1,3-dithiolan-2-yl)phenoxy]acetamide.
| Compound Name | N-[(Z)-(2-bromo-4-hydroxy-5-methoxyphenyl)methylideneamino]-2-[4-(1,3-dithiolan-2-yl)phenoxy]acetamide |
|---|---|
| PubChem CID | 137057643 |
| Molecular Formula | C19H19BrN2O4S2 |
| Molecular Weight | 483.41 g/mol |
| Exact Mass | 482.00 |
| IUPAC Name | N-[(Z)-(2-bromo-4-hydroxy-5-methoxyphenyl)methylideneamino]-2-[4-(1,3-dithiolan-2-yl)phenoxy]acetamide |
| SMILES | COc1cc(/C=N\NC(=O)COc2ccc(C3SCCS3)cc2)c(Br)cc1O |
| InChI | InChI=1S/C19H19BrN2O4S2/c1-25-17-8-13(15(20)9-16(17)23)10-21-22-18(24)11-26-14-4-2-12(3-5-14)19-27-6-7-28-19/h2-5,8-10,19,23H,6-7,11H2,1H3,(H,22,24)/b21-10- |
| InChIKey | FBAQIWBMEBDDRP-FBHDLOMBSA-N |
| XLogP | 4.17 |
| TPSA | 80.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.41 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|