C20H21N3O6S2 — CID 137057697
2-[4-(1,3-dithiolan-2-yl)phenoxy]-N-[(Z)-(3-ethoxy-4-hydroxy-5-nitrophenyl)methylideneamino]acetamide (PubChem CID 137057697) has the molecular formula C20H21N3O6S2 and a molecular weight of 463.54 g/mol. Its IUPAC name is 2-[4-(1,3-dithiolan-2-yl)phenoxy]-N-[(Z)-(3-ethoxy-4-hydroxy-5-nitrophenyl)methylideneamino]acetamide.
| Compound Name | 2-[4-(1,3-dithiolan-2-yl)phenoxy]-N-[(Z)-(3-ethoxy-4-hydroxy-5-nitrophenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 137057697 |
| Molecular Formula | C20H21N3O6S2 |
| Molecular Weight | 463.54 g/mol |
| Exact Mass | 463.09 |
| IUPAC Name | 2-[4-(1,3-dithiolan-2-yl)phenoxy]-N-[(Z)-(3-ethoxy-4-hydroxy-5-nitrophenyl)methylideneamino]acetamide |
| SMILES | CCOc1cc(/C=N\NC(=O)COc2ccc(C3SCCS3)cc2)cc([N+](=O)[O-])c1O |
| InChI | InChI=1S/C20H21N3O6S2/c1-2-28-17-10-13(9-16(19(17)25)23(26)27)11-21-22-18(24)12-29-15-5-3-14(4-6-15)20-30-7-8-31-20/h3-6,9-11,20,25H,2,7-8,12H2,1H3,(H,22,24)/b21-11- |
| InChIKey | ONWCJNYUAMGESW-NHDPSOOVSA-N |
| XLogP | 3.71 |
| TPSA | 123.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.54 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|