C23H26N6O3S — CID 137061619
2-[2-(cyclohexen-1-yl)-4-(2-methylimino-1,3-diazinan-5-yl)phenyl]-1-(5-isocyano-1H-imidazol-2-yl)ethanone;sulfur dioxide (PubChem CID 137061619) has the molecular formula C23H26N6O3S and a molecular weight of 466.57 g/mol. Its IUPAC name is 2-[2-(cyclohexen-1-yl)-4-(2-methylimino-1,3-diazinan-5-yl)phenyl]-1-(5-isocyano-1H-imidazol-2-yl)ethanone;sulfur dioxide.
| Compound Name | 2-[2-(cyclohexen-1-yl)-4-(2-methylimino-1,3-diazinan-5-yl)phenyl]-1-(5-isocyano-1H-imidazol-2-yl)ethanone;sulfur dioxide |
|---|---|
| PubChem CID | 137061619 |
| Molecular Formula | C23H26N6O3S |
| Molecular Weight | 466.57 g/mol |
| Exact Mass | 466.18 |
| IUPAC Name | 2-[2-(cyclohexen-1-yl)-4-(2-methylimino-1,3-diazinan-5-yl)phenyl]-1-(5-isocyano-1H-imidazol-2-yl)ethanone;sulfur dioxide |
| SMILES | O=S=O.[C-]#[N+]c1cnc(C(=O)Cc2ccc(C3CNC(=NC)NC3)cc2C2=CCCCC2)[nH]1 |
| InChI | InChI=1S/C23H26N6O.O2S/c1-24-21-14-26-22(29-21)20(30)11-17-9-8-16(18-12-27-23(25-2)28-13-18)10-19(17)15-6-4-3-5-7-15;1-3-2/h6,8-10,14,18H,3-5,7,11-13H2,2H3,(H,26,29)(H2,25,27,28); |
| InChIKey | IHAKNKPSTKFWHI-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 120.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.57 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|