C18H18ClN5O2 — CID 137061729
4-chloro-2-[[2-[[(2S)-1-hydroxypropan-2-yl]amino]-6-pyridin-4-ylpyrimidin-4-yl]amino]phenol (PubChem CID 137061729) has the molecular formula C18H18ClN5O2 and a molecular weight of 371.83 g/mol. Its IUPAC name is 4-chloro-2-[[2-[[(2S)-1-hydroxypropan-2-yl]amino]-6-pyridin-4-ylpyrimidin-4-yl]amino]phenol.
| Compound Name | 4-chloro-2-[[2-[[(2S)-1-hydroxypropan-2-yl]amino]-6-pyridin-4-ylpyrimidin-4-yl]amino]phenol |
|---|---|
| PubChem CID | 137061729 |
| Molecular Formula | C18H18ClN5O2 |
| Molecular Weight | 371.83 g/mol |
| Exact Mass | 371.11 |
| IUPAC Name | 4-chloro-2-[[2-[[(2S)-1-hydroxypropan-2-yl]amino]-6-pyridin-4-ylpyrimidin-4-yl]amino]phenol |
| SMILES | C[C@@H](CO)Nc1nc(Nc2cc(Cl)ccc2O)cc(-c2ccncc2)n1 |
| InChI | InChI=1S/C18H18ClN5O2/c1-11(10-25)21-18-23-14(12-4-6-20-7-5-12)9-17(24-18)22-15-8-13(19)2-3-16(15)26/h2-9,11,25-26H,10H2,1H3,(H2,21,22,23,24)/t11-/m0/s1 |
| InChIKey | VRRLNDQRHGRNIB-NSHDSACASA-N |
| XLogP | 3.43 |
| TPSA | 103.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.83 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|