C20H22ClN5O2 — CID 137148684
4-chloro-2-[[2-[[(2R)-1-hydroxy-3-methylbutan-2-yl]amino]-6-pyridin-2-ylpyrimidin-4-yl]amino]phenol (PubChem CID 137148684) has the molecular formula C20H22ClN5O2 and a molecular weight of 399.88 g/mol. Its IUPAC name is 4-chloro-2-[[2-[[(2R)-1-hydroxy-3-methylbutan-2-yl]amino]-6-pyridin-2-ylpyrimidin-4-yl]amino]phenol.
| Compound Name | 4-chloro-2-[[2-[[(2R)-1-hydroxy-3-methylbutan-2-yl]amino]-6-pyridin-2-ylpyrimidin-4-yl]amino]phenol |
|---|---|
| PubChem CID | 137148684 |
| Molecular Formula | C20H22ClN5O2 |
| Molecular Weight | 399.88 g/mol |
| Exact Mass | 399.15 |
| IUPAC Name | 4-chloro-2-[[2-[[(2R)-1-hydroxy-3-methylbutan-2-yl]amino]-6-pyridin-2-ylpyrimidin-4-yl]amino]phenol |
| SMILES | CC(C)[C@H](CO)Nc1nc(Nc2cc(Cl)ccc2O)cc(-c2ccccn2)n1 |
| InChI | InChI=1S/C20H22ClN5O2/c1-12(2)17(11-27)25-20-24-15(14-5-3-4-8-22-14)10-19(26-20)23-16-9-13(21)6-7-18(16)28/h3-10,12,17,27-28H,11H2,1-2H3,(H2,23,24,25,26)/t17-/m0/s1 |
| InChIKey | PEAOSXWXDYZECI-KRWDZBQOSA-N |
| XLogP | 4.07 |
| TPSA | 103.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.88 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|