C19H19Cl2N5O — CID 137148638
4-[[2-[[(2S)-butan-2-yl]amino]-6-pyridin-2-ylpyrimidin-4-yl]amino]-2,6-dichlorophenol (PubChem CID 137148638) has the molecular formula C19H19Cl2N5O and a molecular weight of 404.30 g/mol. Its IUPAC name is 4-[[2-[[(2S)-butan-2-yl]amino]-6-pyridin-2-ylpyrimidin-4-yl]amino]-2,6-dichlorophenol.
| Compound Name | 4-[[2-[[(2S)-butan-2-yl]amino]-6-pyridin-2-ylpyrimidin-4-yl]amino]-2,6-dichlorophenol |
|---|---|
| PubChem CID | 137148638 |
| Molecular Formula | C19H19Cl2N5O |
| Molecular Weight | 404.30 g/mol |
| Exact Mass | 403.10 |
| IUPAC Name | 4-[[2-[[(2S)-butan-2-yl]amino]-6-pyridin-2-ylpyrimidin-4-yl]amino]-2,6-dichlorophenol |
| SMILES | CC[C@H](C)Nc1nc(Nc2cc(Cl)c(O)c(Cl)c2)cc(-c2ccccn2)n1 |
| InChI | InChI=1S/C19H19Cl2N5O/c1-3-11(2)23-19-25-16(15-6-4-5-7-22-15)10-17(26-19)24-12-8-13(20)18(27)14(21)9-12/h4-11,27H,3H2,1-2H3,(H2,23,24,25,26)/t11-/m0/s1 |
| InChIKey | IXLREQUJMMNWAN-NSHDSACASA-N |
| XLogP | 5.51 |
| TPSA | 82.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.30 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|