C19H20Cl2N6O — CID 137148651
2,6-dichloro-4-[[2-[2-(dimethylamino)ethylamino]-6-pyridin-2-ylpyrimidin-4-yl]amino]phenol (PubChem CID 137148651) has the molecular formula C19H20Cl2N6O and a molecular weight of 419.32 g/mol. Its IUPAC name is 2,6-dichloro-4-[[2-[2-(dimethylamino)ethylamino]-6-pyridin-2-ylpyrimidin-4-yl]amino]phenol.
| Compound Name | 2,6-dichloro-4-[[2-[2-(dimethylamino)ethylamino]-6-pyridin-2-ylpyrimidin-4-yl]amino]phenol |
|---|---|
| PubChem CID | 137148651 |
| Molecular Formula | C19H20Cl2N6O |
| Molecular Weight | 419.32 g/mol |
| Exact Mass | 418.11 |
| IUPAC Name | 2,6-dichloro-4-[[2-[2-(dimethylamino)ethylamino]-6-pyridin-2-ylpyrimidin-4-yl]amino]phenol |
| SMILES | CN(C)CCNc1nc(Nc2cc(Cl)c(O)c(Cl)c2)cc(-c2ccccn2)n1 |
| InChI | InChI=1S/C19H20Cl2N6O/c1-27(2)8-7-23-19-25-16(15-5-3-4-6-22-15)11-17(26-19)24-12-9-13(20)18(28)14(21)10-12/h3-6,9-11,28H,7-8H2,1-2H3,(H2,23,24,25,26) |
| InChIKey | KBHBJLJQUNGYPA-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 86.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.32 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|