C17H15Cl2N5O2 — CID 137061753
2,6-dichloro-4-[[2-(2-hydroxyethylamino)-6-pyridin-2-ylpyrimidin-4-yl]amino]phenol (PubChem CID 137061753) has the molecular formula C17H15Cl2N5O2 and a molecular weight of 392.25 g/mol. Its IUPAC name is 2,6-dichloro-4-[[2-(2-hydroxyethylamino)-6-pyridin-2-ylpyrimidin-4-yl]amino]phenol.
| Compound Name | 2,6-dichloro-4-[[2-(2-hydroxyethylamino)-6-pyridin-2-ylpyrimidin-4-yl]amino]phenol |
|---|---|
| PubChem CID | 137061753 |
| Molecular Formula | C17H15Cl2N5O2 |
| Molecular Weight | 392.25 g/mol |
| Exact Mass | 391.06 |
| IUPAC Name | 2,6-dichloro-4-[[2-(2-hydroxyethylamino)-6-pyridin-2-ylpyrimidin-4-yl]amino]phenol |
| SMILES | OCCNc1nc(Nc2cc(Cl)c(O)c(Cl)c2)cc(-c2ccccn2)n1 |
| InChI | InChI=1S/C17H15Cl2N5O2/c18-11-7-10(8-12(19)16(11)26)22-15-9-14(13-3-1-2-4-20-13)23-17(24-15)21-5-6-25/h1-4,7-9,25-26H,5-6H2,(H2,21,22,23,24) |
| InChIKey | ZKAFRLTZDUHGPP-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 103.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.25 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|