C21H21Cl2N5O — CID 137061750
2,6-dichloro-4-[[2-(cyclohexylamino)-6-pyridin-2-ylpyrimidin-4-yl]amino]phenol (PubChem CID 137061750) has the molecular formula C21H21Cl2N5O and a molecular weight of 430.34 g/mol. Its IUPAC name is 2,6-dichloro-4-[[2-(cyclohexylamino)-6-pyridin-2-ylpyrimidin-4-yl]amino]phenol.
| Compound Name | 2,6-dichloro-4-[[2-(cyclohexylamino)-6-pyridin-2-ylpyrimidin-4-yl]amino]phenol |
|---|---|
| PubChem CID | 137061750 |
| Molecular Formula | C21H21Cl2N5O |
| Molecular Weight | 430.34 g/mol |
| Exact Mass | 429.11 |
| IUPAC Name | 2,6-dichloro-4-[[2-(cyclohexylamino)-6-pyridin-2-ylpyrimidin-4-yl]amino]phenol |
| SMILES | Oc1c(Cl)cc(Nc2cc(-c3ccccn3)nc(NC3CCCCC3)n2)cc1Cl |
| InChI | InChI=1S/C21H21Cl2N5O/c22-15-10-14(11-16(23)20(15)29)25-19-12-18(17-8-4-5-9-24-17)27-21(28-19)26-13-6-2-1-3-7-13/h4-5,8-13,29H,1-3,6-7H2,(H2,25,26,27,28) |
| InChIKey | YMHFEDBMWCPXAD-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 82.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.34 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|