C21H22ClN5O — CID 137061747
3-chloro-4-[[2-(cyclohexylamino)-6-pyridin-4-ylpyrimidin-4-yl]amino]phenol (PubChem CID 137061747) has the molecular formula C21H22ClN5O and a molecular weight of 395.89 g/mol. Its IUPAC name is 3-chloro-4-[[2-(cyclohexylamino)-6-pyridin-4-ylpyrimidin-4-yl]amino]phenol.
| Compound Name | 3-chloro-4-[[2-(cyclohexylamino)-6-pyridin-4-ylpyrimidin-4-yl]amino]phenol |
|---|---|
| PubChem CID | 137061747 |
| Molecular Formula | C21H22ClN5O |
| Molecular Weight | 395.89 g/mol |
| Exact Mass | 395.15 |
| IUPAC Name | 3-chloro-4-[[2-(cyclohexylamino)-6-pyridin-4-ylpyrimidin-4-yl]amino]phenol |
| SMILES | Oc1ccc(Nc2cc(-c3ccncc3)nc(NC3CCCCC3)n2)c(Cl)c1 |
| InChI | InChI=1S/C21H22ClN5O/c22-17-12-16(28)6-7-18(17)25-20-13-19(14-8-10-23-11-9-14)26-21(27-20)24-15-4-2-1-3-5-15/h6-13,15,28H,1-5H2,(H2,24,25,26,27) |
| InChIKey | YFJZHPCKTCFXQN-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 82.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.89 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|