C17H15Cl2N5O — CID 137161882
2,6-dichloro-4-[[2-(ethylamino)-6-pyridin-4-ylpyrimidin-4-yl]amino]phenol (PubChem CID 137161882) has the molecular formula C17H15Cl2N5O and a molecular weight of 376.25 g/mol. Its IUPAC name is 2,6-dichloro-4-[[2-(ethylamino)-6-pyridin-4-ylpyrimidin-4-yl]amino]phenol.
| Compound Name | 2,6-dichloro-4-[[2-(ethylamino)-6-pyridin-4-ylpyrimidin-4-yl]amino]phenol |
|---|---|
| PubChem CID | 137161882 |
| Molecular Formula | C17H15Cl2N5O |
| Molecular Weight | 376.25 g/mol |
| Exact Mass | 375.07 |
| IUPAC Name | 2,6-dichloro-4-[[2-(ethylamino)-6-pyridin-4-ylpyrimidin-4-yl]amino]phenol |
| SMILES | CCNc1nc(Nc2cc(Cl)c(O)c(Cl)c2)cc(-c2ccncc2)n1 |
| InChI | InChI=1S/C17H15Cl2N5O/c1-2-21-17-23-14(10-3-5-20-6-4-10)9-15(24-17)22-11-7-12(18)16(25)13(19)8-11/h3-9,25H,2H2,1H3,(H2,21,22,23,24) |
| InChIKey | BTDSANBUKBOXNR-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 82.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.25 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|