C29H21BrClN3O5S — CID 137063441
(5E)-5-[[3-bromo-5-ethoxy-4-(naphthalen-1-ylmethoxy)phenyl]methylidene]-2-(4-chloro-2-nitrophenyl)imino-1,3-thiazolidin-4-one (PubChem CID 137063441) has the molecular formula C29H21BrClN3O5S and a molecular weight of 638.93 g/mol. Its IUPAC name is (5E)-5-[[3-bromo-5-ethoxy-4-(naphthalen-1-ylmethoxy)phenyl]methylidene]-2-(4-chloro-2-nitrophenyl)imino-1,3-thiazolidin-4-one.
| Compound Name | (5E)-5-[[3-bromo-5-ethoxy-4-(naphthalen-1-ylmethoxy)phenyl]methylidene]-2-(4-chloro-2-nitrophenyl)imino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 137063441 |
| Molecular Formula | C29H21BrClN3O5S |
| Molecular Weight | 638.93 g/mol |
| Exact Mass | 637.01 |
| IUPAC Name | (5E)-5-[[3-bromo-5-ethoxy-4-(naphthalen-1-ylmethoxy)phenyl]methylidene]-2-(4-chloro-2-nitrophenyl)imino-1,3-thiazolidin-4-one |
| SMILES | CCOc1cc(/C=C2/S/C(=N\c3ccc(Cl)cc3[N+](=O)[O-])NC2=O)cc(Br)c1OCc1cccc2ccccc12 |
| InChI | InChI=1S/C29H21BrClN3O5S/c1-2-38-25-13-17(12-22(30)27(25)39-16-19-8-5-7-18-6-3-4-9-21(18)19)14-26-28(35)33-29(40-26)32-23-11-10-20(31)15-24(23)34(36)37/h3-15H,2,16H2,1H3,(H,32,33,35)/b26-14+ |
| InChIKey | APYXEBZOJRSWRG-VULFUBBASA-N |
| XLogP | 8.03 |
| TPSA | 103.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.93 |
| LogP ≤ 5 | 8.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|