C22H28N4O4S — CID 137075456
[2-[(2R,6R)-2,6-dimethylpiperidin-1-yl]-2-oxoethyl] 4-hydroxy-1,3-dimethyl-2,6-dioxo-N-phenylpyrimidine-5-carboximidothioate (PubChem CID 137075456) has the molecular formula C22H28N4O4S and a molecular weight of 444.56 g/mol. Its IUPAC name is [2-[(2R,6R)-2,6-dimethylpiperidin-1-yl]-2-oxoethyl] 4-hydroxy-1,3-dimethyl-2,6-dioxo-N-phenylpyrimidine-5-carboximidothioate.
| Compound Name | [2-[(2R,6R)-2,6-dimethylpiperidin-1-yl]-2-oxoethyl] 4-hydroxy-1,3-dimethyl-2,6-dioxo-N-phenylpyrimidine-5-carboximidothioate |
|---|---|
| PubChem CID | 137075456 |
| Molecular Formula | C22H28N4O4S |
| Molecular Weight | 444.56 g/mol |
| Exact Mass | 444.18 |
| IUPAC Name | [2-[(2R,6R)-2,6-dimethylpiperidin-1-yl]-2-oxoethyl] 4-hydroxy-1,3-dimethyl-2,6-dioxo-N-phenylpyrimidine-5-carboximidothioate |
| SMILES | C[C@@H]1CCC[C@@H](C)N1C(=O)CS/C(=N\c1ccccc1)c1c(O)n(C)c(=O)n(C)c1=O |
| InChI | InChI=1S/C22H28N4O4S/c1-14-9-8-10-15(2)26(14)17(27)13-31-19(23-16-11-6-5-7-12-16)18-20(28)24(3)22(30)25(4)21(18)29/h5-7,11-12,14-15,28H,8-10,13H2,1-4H3/b23-19-/t14-,15-/m1/s1 |
| InChIKey | WBHKAPHRDZIRFX-KCYHKGEQSA-N |
| XLogP | 2.39 |
| TPSA | 96.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.56 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|