C11H14N2O2S — CID 137082129
2-amino-3-[1-(4-sulfanylphenyl)ethylideneamino]propanoic acid (PubChem CID 137082129) has the molecular formula C11H14N2O2S and a molecular weight of 238.31 g/mol. Its IUPAC name is 2-amino-3-[1-(4-sulfanylphenyl)ethylideneamino]propanoic acid.
| Compound Name | 2-amino-3-[1-(4-sulfanylphenyl)ethylideneamino]propanoic acid |
|---|---|
| PubChem CID | 137082129 |
| Molecular Formula | C11H14N2O2S |
| Molecular Weight | 238.31 g/mol |
| Exact Mass | 238.08 |
| IUPAC Name | 2-amino-3-[1-(4-sulfanylphenyl)ethylideneamino]propanoic acid |
| SMILES | C/C(=N\CC(N)C(=O)O)c1ccc(S)cc1 |
| InChI | InChI=1S/C11H14N2O2S/c1-7(13-6-10(12)11(14)15)8-2-4-9(16)5-3-8/h2-5,10,16H,6,12H2,1H3,(H,14,15)/b13-7+ |
| InChIKey | PFSWNBKOMBNVMT-NTUHNPAUSA-N |
| XLogP | 1.20 |
| TPSA | 75.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.31 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|