C16H14N2O4S2 — CID 137091562
3-[(3-ethyl-4-hydroxy-2-sulfanylidene-1,3-thiazol-5-yl)methylidene]-6-methoxyindole-2-carboxylic acid (PubChem CID 137091562) has the molecular formula C16H14N2O4S2 and a molecular weight of 362.43 g/mol. Its IUPAC name is 3-[(3-ethyl-4-hydroxy-2-sulfanylidene-1,3-thiazol-5-yl)methylidene]-6-methoxyindole-2-carboxylic acid.
| Compound Name | 3-[(3-ethyl-4-hydroxy-2-sulfanylidene-1,3-thiazol-5-yl)methylidene]-6-methoxyindole-2-carboxylic acid |
|---|---|
| PubChem CID | 137091562 |
| Molecular Formula | C16H14N2O4S2 |
| Molecular Weight | 362.43 g/mol |
| Exact Mass | 362.04 |
| IUPAC Name | 3-[(3-ethyl-4-hydroxy-2-sulfanylidene-1,3-thiazol-5-yl)methylidene]-6-methoxyindole-2-carboxylic acid |
| SMILES | CCn1c(O)c(C=C2C(C(=O)O)=Nc3cc(OC)ccc32)sc1=S |
| InChI | InChI=1S/C16H14N2O4S2/c1-3-18-14(19)12(24-16(18)23)7-10-9-5-4-8(22-2)6-11(9)17-13(10)15(20)21/h4-7,19H,3H2,1-2H3,(H,20,21) |
| InChIKey | DQFXZJZLANWPTR-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 84.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.43 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|