C21H15F3N2O3S — CID 137093530
4-[5-methyl-3-[[2-(trifluoromethyl)benzoyl]amino]thiophene-2-carboximidoyl]benzoic acid (PubChem CID 137093530) has the molecular formula C21H15F3N2O3S and a molecular weight of 432.42 g/mol. Its IUPAC name is 4-[5-methyl-3-[[2-(trifluoromethyl)benzoyl]amino]thiophene-2-carboximidoyl]benzoic acid.
| Compound Name | 4-[5-methyl-3-[[2-(trifluoromethyl)benzoyl]amino]thiophene-2-carboximidoyl]benzoic acid |
|---|---|
| PubChem CID | 137093530 |
| Molecular Formula | C21H15F3N2O3S |
| Molecular Weight | 432.42 g/mol |
| Exact Mass | 432.08 |
| IUPAC Name | 4-[5-methyl-3-[[2-(trifluoromethyl)benzoyl]amino]thiophene-2-carboximidoyl]benzoic acid |
| SMILES | [H]/N=C(\c1ccc(C(=O)O)cc1)c1sc(C)cc1NC(=O)c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C21H15F3N2O3S/c1-11-10-16(26-19(27)14-4-2-3-5-15(14)21(22,23)24)18(30-11)17(25)12-6-8-13(9-7-12)20(28)29/h2-10,25H,1H3,(H,26,27)(H,28,29)/b25-17+ |
| InChIKey | NIRZDWWIOPICRJ-KOEQRZSOSA-N |
| XLogP | 5.44 |
| TPSA | 90.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.42 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|