C24H22ClF3N4O5S — CID 137094081
[2-[4-chloro-3-(trifluoromethyl)anilino]-2-oxoethyl] N-(4-ethoxyphenyl)-4-hydroxy-1,3-dimethyl-2,6-dioxopyrimidine-5-carboximidothioate (PubChem CID 137094081) has the molecular formula C24H22ClF3N4O5S and a molecular weight of 570.98 g/mol. Its IUPAC name is [2-[4-chloro-3-(trifluoromethyl)anilino]-2-oxoethyl] N-(4-ethoxyphenyl)-4-hydroxy-1,3-dimethyl-2,6-dioxopyrimidine-5-carboximidothioate.
| Compound Name | [2-[4-chloro-3-(trifluoromethyl)anilino]-2-oxoethyl] N-(4-ethoxyphenyl)-4-hydroxy-1,3-dimethyl-2,6-dioxopyrimidine-5-carboximidothioate |
|---|---|
| PubChem CID | 137094081 |
| Molecular Formula | C24H22ClF3N4O5S |
| Molecular Weight | 570.98 g/mol |
| Exact Mass | 570.10 |
| IUPAC Name | [2-[4-chloro-3-(trifluoromethyl)anilino]-2-oxoethyl] N-(4-ethoxyphenyl)-4-hydroxy-1,3-dimethyl-2,6-dioxopyrimidine-5-carboximidothioate |
| SMILES | CCOc1ccc(/N=C(\SCC(=O)Nc2ccc(Cl)c(C(F)(F)F)c2)c2c(O)n(C)c(=O)n(C)c2=O)cc1 |
| InChI | InChI=1S/C24H22ClF3N4O5S/c1-4-37-15-8-5-13(6-9-15)30-20(19-21(34)31(2)23(36)32(3)22(19)35)38-12-18(33)29-14-7-10-17(25)16(11-14)24(26,27)28/h5-11,34H,4,12H2,1-3H3,(H,29,33)/b30-20- |
| InChIKey | GPUVMLZKAPVYRA-COEJQBHMSA-N |
| XLogP | 4.31 |
| TPSA | 114.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.98 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|