C17H20N6O2 — CID 137094490
1-[(2-ethoxy-3-pyridinyl)methyl]-3-(8-ethylimino-3,7-diazabicyclo[4.2.0]octa-1,3,5-trien-4-yl)urea (PubChem CID 137094490) has the molecular formula C17H20N6O2 and a molecular weight of 340.39 g/mol. Its IUPAC name is 1-[(2-ethoxy-3-pyridinyl)methyl]-3-(8-ethylimino-3,7-diazabicyclo[4.2.0]octa-1,3,5-trien-4-yl)urea.
| Compound Name | 1-[(2-ethoxy-3-pyridinyl)methyl]-3-(8-ethylimino-3,7-diazabicyclo[4.2.0]octa-1,3,5-trien-4-yl)urea |
|---|---|
| PubChem CID | 137094490 |
| Molecular Formula | C17H20N6O2 |
| Molecular Weight | 340.39 g/mol |
| Exact Mass | 340.16 |
| IUPAC Name | 1-[(2-ethoxy-3-pyridinyl)methyl]-3-(8-ethylimino-3,7-diazabicyclo[4.2.0]octa-1,3,5-trien-4-yl)urea |
| SMILES | CC/N=C1\Nc2cc(NC(=O)NCc3cccnc3OCC)ncc21 |
| InChI | InChI=1S/C17H20N6O2/c1-3-18-15-12-10-20-14(8-13(12)22-15)23-17(24)21-9-11-6-5-7-19-16(11)25-4-2/h5-8,10H,3-4,9H2,1-2H3,(H,18,22)(H2,20,21,23,24) |
| InChIKey | QAECIOYKKCTORF-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 100.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.39 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|