C30H41N7O5 — CID 137095070
2-ethylbutyl 2-cyano-3-[4-[6-[(4-ethyl-6-oxo-1H-pyrimidin-2-yl)carbamoylamino]hexylcarbamoylamino]phenyl]prop-2-enoate (PubChem CID 137095070) has the molecular formula C30H41N7O5 and a molecular weight of 579.70 g/mol. Its IUPAC name is 2-ethylbutyl 2-cyano-3-[4-[6-[(4-ethyl-6-oxo-1H-pyrimidin-2-yl)carbamoylamino]hexylcarbamoylamino]phenyl]prop-2-enoate.
| Compound Name | 2-ethylbutyl 2-cyano-3-[4-[6-[(4-ethyl-6-oxo-1H-pyrimidin-2-yl)carbamoylamino]hexylcarbamoylamino]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 137095070 |
| Molecular Formula | C30H41N7O5 |
| Molecular Weight | 579.70 g/mol |
| Exact Mass | 579.32 |
| IUPAC Name | 2-ethylbutyl 2-cyano-3-[4-[6-[(4-ethyl-6-oxo-1H-pyrimidin-2-yl)carbamoylamino]hexylcarbamoylamino]phenyl]prop-2-enoate |
| SMILES | CCc1cc(=O)[nH]c(NC(=O)NCCCCCCNC(=O)Nc2ccc(C=C(C#N)C(=O)OCC(CC)CC)cc2)n1 |
| InChI | InChI=1S/C30H41N7O5/c1-4-21(5-2)20-42-27(39)23(19-31)17-22-11-13-25(14-12-22)35-29(40)32-15-9-7-8-10-16-33-30(41)37-28-34-24(6-3)18-26(38)36-28/h11-14,17-18,21H,4-10,15-16,20H2,1-3H3,(H2,32,35,40)(H3,33,34,36,37,38,41) |
| InChIKey | SFNBNUXCPDJSBN-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 178.10 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.70 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|