C41H55N15O6 — CID 136591335
2-ethylhexyl (E)-3-[4-[[4,6-bis[4-[(4-methyl-6-oxo-1H-pyrimidin-2-yl)carbamoylamino]butylamino]-1,3,5-triazin-2-yl]amino]phenyl]-2-cyanoprop-2-enoate (PubChem CID 136591335) has the molecular formula C41H55N15O6 and a molecular weight of 853.99 g/mol. Its IUPAC name is 2-ethylhexyl (E)-3-[4-[[4,6-bis[4-[(4-methyl-6-oxo-1H-pyrimidin-2-yl)carbamoylamino]butylamino]-1,3,5-triazin-2-yl]amino]phenyl]-2-cyanoprop-2-enoate.
| Compound Name | 2-ethylhexyl (E)-3-[4-[[4,6-bis[4-[(4-methyl-6-oxo-1H-pyrimidin-2-yl)carbamoylamino]butylamino]-1,3,5-triazin-2-yl]amino]phenyl]-2-cyanoprop-2-enoate |
|---|---|
| PubChem CID | 136591335 |
| Molecular Formula | C41H55N15O6 |
| Molecular Weight | 853.99 g/mol |
| Exact Mass | 853.45 |
| IUPAC Name | 2-ethylhexyl (E)-3-[4-[[4,6-bis[4-[(4-methyl-6-oxo-1H-pyrimidin-2-yl)carbamoylamino]butylamino]-1,3,5-triazin-2-yl]amino]phenyl]-2-cyanoprop-2-enoate |
| SMILES | CCCCC(CC)COC(=O)/C(C#N)=C/c1ccc(Nc2nc(NCCCCNC(=O)Nc3nc(C)cc(=O)[nH]3)nc(NCCCCNC(=O)Nc3nc(C)cc(=O)[nH]3)n2)cc1 |
| InChI | InChI=1S/C41H55N15O6/c1-5-7-12-28(6-2)25-62-34(59)30(24-42)23-29-13-15-31(16-14-29)49-39-53-35(43-17-8-10-19-45-40(60)55-37-47-26(3)21-32(57)50-37)52-36(54-39)44-18-9-11-20-46-41(61)56-38-48-27(4)22-33(58)51-38/h13-16,21-23,28H,5-12,17-20,25H2,1-4H3,(H3,43,44,49,52,53,54)(H3,45,47,50,55,57,60)(H3,46,48,51,56,58,61)/b30-23+ |
| InChIKey | MCTNQIMVHHUHJV-JJKYIXSRSA-N |
| XLogP | 5.09 |
| TPSA | 298.61 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 62 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 853.99 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|