C27H49N5O4Y-2 — CID 140719278
(4-methyl-6-oxo-1H-pyrimidin-2-yl)carbamoylazanide;2-octyldodecoxycarbonylazanide;yttrium (PubChem CID 140719278) has the molecular formula C27H49N5O4Y-2 and a molecular weight of 596.63 g/mol. Its IUPAC name is (4-methyl-6-oxo-1H-pyrimidin-2-yl)carbamoylazanide;2-octyldodecoxycarbonylazanide;yttrium.
| Compound Name | (4-methyl-6-oxo-1H-pyrimidin-2-yl)carbamoylazanide;2-octyldodecoxycarbonylazanide;yttrium |
|---|---|
| PubChem CID | 140719278 |
| Molecular Formula | C27H49N5O4Y-2 |
| Molecular Weight | 596.63 g/mol |
| Exact Mass | 596.29 |
| IUPAC Name | (4-methyl-6-oxo-1H-pyrimidin-2-yl)carbamoylazanide;2-octyldodecoxycarbonylazanide;yttrium |
| SMILES | CCCCCCCCCCC(CCCCCCCC)COC([NH-])=O.Cc1cc(=O)[nH]c(NC([NH-])=O)n1.[Y] |
| InChI | InChI=1S/C21H43NO2.C6H8N4O2.Y/c1-3-5-7-9-11-12-14-16-18-20(19-24-21(22)23)17-15-13-10-8-6-4-2;1-3-2-4(11)9-6(8-3)10-5(7)12;/h20H,3-19H2,1-2H3,(H2,22,23);2H,1H3,(H4,7,8,9,10,11,12);/p-2 |
| InChIKey | NPOGWQLKEOKDMJ-UHFFFAOYSA-L |
| XLogP | 8.73 |
| TPSA | 148.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.63 |
| LogP ≤ 5 | 8.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|