C26H22N4S — CID 137102453
4-(5-ethyl-3-pyridinyl)-2-(4-thiophen-3-yl-1H-indole-2-carboximidoyl)aniline (PubChem CID 137102453) has the molecular formula C26H22N4S and a molecular weight of 422.56 g/mol. Its IUPAC name is 4-(5-ethyl-3-pyridinyl)-2-(4-thiophen-3-yl-1H-indole-2-carboximidoyl)aniline.
| Compound Name | 4-(5-ethyl-3-pyridinyl)-2-(4-thiophen-3-yl-1H-indole-2-carboximidoyl)aniline |
|---|---|
| PubChem CID | 137102453 |
| Molecular Formula | C26H22N4S |
| Molecular Weight | 422.56 g/mol |
| Exact Mass | 422.16 |
| IUPAC Name | 4-(5-ethyl-3-pyridinyl)-2-(4-thiophen-3-yl-1H-indole-2-carboximidoyl)aniline |
| SMILES | [H]/N=C(/c1cc2c(-c3ccsc3)cccc2[nH]1)c1cc(-c2cncc(CC)c2)ccc1N |
| InChI | InChI=1S/C26H22N4S/c1-2-16-10-19(14-29-13-16)17-6-7-23(27)22(11-17)26(28)25-12-21-20(18-8-9-31-15-18)4-3-5-24(21)30-25/h3-15,28,30H,2,27H2,1H3/b28-26+ |
| InChIKey | QNHYMZZSTMIDQD-BYCLXTJYSA-N |
| XLogP | 6.52 |
| TPSA | 78.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.56 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|