C28H27N5O — CID 145247953
6-[4-amino-3-[4-(furan-3-yl)-1H-indole-2-carboximidoyl]phenyl]-N-propan-2-yl-1H-azepin-4-amine (PubChem CID 145247953) has the molecular formula C28H27N5O and a molecular weight of 449.56 g/mol. Its IUPAC name is 6-[4-amino-3-[4-(furan-3-yl)-1H-indole-2-carboximidoyl]phenyl]-N-propan-2-yl-1H-azepin-4-amine.
| Compound Name | 6-[4-amino-3-[4-(furan-3-yl)-1H-indole-2-carboximidoyl]phenyl]-N-propan-2-yl-1H-azepin-4-amine |
|---|---|
| PubChem CID | 145247953 |
| Molecular Formula | C28H27N5O |
| Molecular Weight | 449.56 g/mol |
| Exact Mass | 449.22 |
| IUPAC Name | 6-[4-amino-3-[4-(furan-3-yl)-1H-indole-2-carboximidoyl]phenyl]-N-propan-2-yl-1H-azepin-4-amine |
| SMILES | [H]/N=C(\c1cc2c(-c3ccoc3)cccc2[nH]1)c1cc(C2=CNC=CC(NC(C)C)=C2)ccc1N |
| InChI | InChI=1S/C28H27N5O/c1-17(2)32-21-8-10-31-15-20(12-21)18-6-7-25(29)24(13-18)28(30)27-14-23-22(19-9-11-34-16-19)4-3-5-26(23)33-27/h3-17,30-33H,29H2,1-2H3/b30-28- |
| InChIKey | LMBLJKAYYMTFBV-HYOGKJQXSA-N |
| XLogP | 5.77 |
| TPSA | 102.86 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.56 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|