C16H17ClN6O — CID 138706188
2-[4-amino-6-(propan-2-ylamino)pyrimidine-5-carboximidoyl]-4-chloro-1H-indol-5-ol (PubChem CID 138706188) has the molecular formula C16H17ClN6O and a molecular weight of 344.81 g/mol. Its IUPAC name is 2-[4-amino-6-(propan-2-ylamino)pyrimidine-5-carboximidoyl]-4-chloro-1H-indol-5-ol.
| Compound Name | 2-[4-amino-6-(propan-2-ylamino)pyrimidine-5-carboximidoyl]-4-chloro-1H-indol-5-ol |
|---|---|
| PubChem CID | 138706188 |
| Molecular Formula | C16H17ClN6O |
| Molecular Weight | 344.81 g/mol |
| Exact Mass | 344.12 |
| IUPAC Name | 2-[4-amino-6-(propan-2-ylamino)pyrimidine-5-carboximidoyl]-4-chloro-1H-indol-5-ol |
| SMILES | [H]/N=C(\c1cc2c(Cl)c(O)ccc2[nH]1)c1c(N)ncnc1NC(C)C |
| InChI | InChI=1S/C16H17ClN6O/c1-7(2)22-16-12(15(19)20-6-21-16)14(18)10-5-8-9(23-10)3-4-11(24)13(8)17/h3-7,18,23-24H,1-2H3,(H3,19,20,21,22)/b18-14+ |
| InChIKey | XGUHTGYSROHJSZ-NBVRZTHBSA-N |
| XLogP | 3.14 |
| TPSA | 123.70 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.81 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|