C17H19FN6O — CID 178092655
5-[4-amino-6-(propan-2-ylamino)pyrimidine-5-carboximidoyl]-6-fluoro-2,3-dihydroindole-1-carbaldehyde (PubChem CID 178092655) has the molecular formula C17H19FN6O and a molecular weight of 342.38 g/mol. Its IUPAC name is 5-[4-amino-6-(propan-2-ylamino)pyrimidine-5-carboximidoyl]-6-fluoro-2,3-dihydroindole-1-carbaldehyde.
| Compound Name | 5-[4-amino-6-(propan-2-ylamino)pyrimidine-5-carboximidoyl]-6-fluoro-2,3-dihydroindole-1-carbaldehyde |
|---|---|
| PubChem CID | 178092655 |
| Molecular Formula | C17H19FN6O |
| Molecular Weight | 342.38 g/mol |
| Exact Mass | 342.16 |
| IUPAC Name | 5-[4-amino-6-(propan-2-ylamino)pyrimidine-5-carboximidoyl]-6-fluoro-2,3-dihydroindole-1-carbaldehyde |
| SMILES | [H]/N=C(\c1cc2c(cc1F)N(C=O)CC2)c1c(N)ncnc1NC(C)C |
| InChI | InChI=1S/C17H19FN6O/c1-9(2)23-17-14(16(20)21-7-22-17)15(19)11-5-10-3-4-24(8-25)13(10)6-12(11)18/h5-9,19H,3-4H2,1-2H3,(H3,20,21,22,23)/b19-15+ |
| InChIKey | JIVAANZYUMNJDY-XDJHFCHBSA-N |
| XLogP | 1.95 |
| TPSA | 107.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.38 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|