C17H21N7O — CID 178092685
(Z)-2-[4-[4-amino-6-(propan-2-ylamino)pyrimidine-5-carboximidoyl]-2H-pyridin-1-yl]-3-(methylideneamino)prop-2-enal (PubChem CID 178092685) has the molecular formula C17H21N7O and a molecular weight of 339.40 g/mol. Its IUPAC name is (Z)-2-[4-[4-amino-6-(propan-2-ylamino)pyrimidine-5-carboximidoyl]-2H-pyridin-1-yl]-3-(methylideneamino)prop-2-enal.
| Compound Name | (Z)-2-[4-[4-amino-6-(propan-2-ylamino)pyrimidine-5-carboximidoyl]-2H-pyridin-1-yl]-3-(methylideneamino)prop-2-enal |
|---|---|
| PubChem CID | 178092685 |
| Molecular Formula | C17H21N7O |
| Molecular Weight | 339.40 g/mol |
| Exact Mass | 339.18 |
| IUPAC Name | (Z)-2-[4-[4-amino-6-(propan-2-ylamino)pyrimidine-5-carboximidoyl]-2H-pyridin-1-yl]-3-(methylideneamino)prop-2-enal |
| SMILES | [H]/N=C(\C1=CCN(/C(C=O)=C\N=C)C=C1)c1c(N)ncnc1NC(C)C |
| InChI | InChI=1S/C17H21N7O/c1-11(2)23-17-14(16(19)21-10-22-17)15(18)12-4-6-24(7-5-12)13(9-25)8-20-3/h4-6,8-11,18H,3,7H2,1-2H3,(H3,19,21,22,23)/b13-8-,18-15+ |
| InChIKey | ZJMXCYZMXXHQNV-XUGXDJALSA-N |
| XLogP | 1.74 |
| TPSA | 120.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.40 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|